C26H38NO3+ — CID 7033971
[1-[(4S)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]piperidin-1-ium-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 7033971) has the molecular formula C26H38NO3+ and a molecular weight of 412.59 g/mol. Its IUPAC name is [1-[(4S)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]piperidin-1-ium-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [1-[(4S)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]piperidin-1-ium-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 7033971 |
| Molecular Formula | C26H38NO3+ |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [1-[(4S)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]piperidin-1-ium-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[N+]1(CC#C[C@@](O)(c2ccccc2)C2CCCC2)CCCCC1 |
| InChI | InChI=1S/C26H38NO3/c1-25(2,3)24(28)30-21-27(18-10-5-11-19-27)20-12-17-26(29,23-15-8-9-16-23)22-13-6-4-7-14-22/h4,6-7,13-14,23,29H,5,8-11,15-16,18-21H2,1-3H3/q+1/t26-/m1/s1 |
| InChIKey | RDBUUBZGNPEXNZ-AREMUKBSSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|