C19H28NOS+ — CID 134117665
1-cyclohexyl-4-(1-methylpyrrolidin-1-ium-1-yl)-1-thiophen-2-ylbut-2-yn-1-ol (PubChem CID 134117665) has the molecular formula C19H28NOS+ and a molecular weight of 318.51 g/mol. Its IUPAC name is 1-cyclohexyl-4-(1-methylpyrrolidin-1-ium-1-yl)-1-thiophen-2-ylbut-2-yn-1-ol.
| Compound Name | 1-cyclohexyl-4-(1-methylpyrrolidin-1-ium-1-yl)-1-thiophen-2-ylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 134117665 |
| Molecular Formula | C19H28NOS+ |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-cyclohexyl-4-(1-methylpyrrolidin-1-ium-1-yl)-1-thiophen-2-ylbut-2-yn-1-ol |
| SMILES | C[N+]1(CC#CC(O)(c2cccs2)C2CCCCC2)CCCC1 |
| InChI | InChI=1S/C19H28NOS/c1-20(13-5-6-14-20)15-8-12-19(21,18-11-7-16-22-18)17-9-3-2-4-10-17/h7,11,16-17,21H,2-6,9-10,13-15H2,1H3/q+1 |
| InChIKey | SDZNOKNYCSGGIY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|