C15H18O3S — CID 19817183
prop-2-ynyl 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 19817183) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is prop-2-ynyl 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | prop-2-ynyl 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 19817183 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | prop-2-ynyl 2-cyclohexyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | C#CCOC(=O)C(O)(c1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C15H18O3S/c1-2-10-18-14(16)15(17,13-9-6-11-19-13)12-7-4-3-5-8-12/h1,6,9,11-12,17H,3-5,7-8,10H2 |
| InChIKey | DBAORVMSDUTQKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|