C19H27NO3S — CID 122689779
7-azaspiro[3.5]nonan-2-yl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 122689779) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 7-azaspiro[3.5]nonan-2-yl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | 7-azaspiro[3.5]nonan-2-yl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 122689779 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 7-azaspiro[3.5]nonan-2-yl 2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | O=C(OC1CC2(CCNCC2)C1)C(O)(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C19H27NO3S/c21-17(23-15-12-18(13-15)7-9-20-10-8-18)19(22,14-4-1-2-5-14)16-6-3-11-24-16/h3,6,11,14-15,20,22H,1-2,4-5,7-10,12-13H2 |
| InChIKey | AIDAJSNWAVORQP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |