C20H25NO3S2 — CID 155669124
[7-(methylamino)spiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 155669124) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is [7-(methylamino)spiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [7-(methylamino)spiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 155669124 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [7-(methylamino)spiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CNC1CCC2(CC1)CC(OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C20H25NO3S2/c1-21-14-6-8-19(9-7-14)12-15(13-19)24-18(22)20(23,16-4-2-10-25-16)17-5-3-11-26-17/h2-5,10-11,14-15,21,23H,6-9,12-13H2,1H3 |
| InChIKey | WCXGHFOHRTWYMG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |