About 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane
7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane (PubChem CID 145233949) has the molecular formula C21H29NO3S2
and a molecular weight of 407.60 g/mol. Its IUPAC name is 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane.
Molecular Properties
| Compound Name | 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane |
| PubChem CID | 145233949 |
| Molecular Formula | C21H29NO3S2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane |
| SMILES | CCC.O=C(OC1CC2(CCNCC2)C1)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C18H21NO3S2.C3H8/c20-16(22-13-11-17(12-13)5-7-19-8-6-17)18(21,14-3-1-9-23-14)15-4-2-10-24-15;1-3-2/h1-4,9-10,13,19,21H,5-8,11-12H2;3H2,1-2H3 |
| InChIKey | SKWOHMCKXCJRKN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane?
The IUPAC name of 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane (CID 145233949) is 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane.
What is the SMILES notation for 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane?
The canonical SMILES for 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane is CCC.O=C(OC1CC2(CCNCC2)C1)C(O)(c1cccs1)c1cccs1.
What is the InChIKey of 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane?
The InChIKey is SKWOHMCKXCJRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3S2.C3H8/c20-16(22-13-11-17(12-13)5-7-19-8-6-17)18(21,14-3-1-9-23-14)15-4-2-10-24-15;1-3-2/h1-4,9-10,13,19,21H,5-8,11-12H2;3H2,1-2H3.
What are the key properties of 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane?
7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane has a molecular weight of 407.60 g/mol, XLogP of 4.54, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azaspiro[3.5]nonan-2-yl 2-hydroxy-2,2-dithiophen-2-ylacetate;propane is sourced from PubChem (CID 145233949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).