C20H22NO5S2+ — CID 163575035
[(3S,8S,10S)-6,6-dimethyl-9,11-dioxa-6-azoniatetracyclo[5.4.0.01,5.08,10]undecan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 163575035) has the molecular formula C20H22NO5S2+ and a molecular weight of 420.53 g/mol. Its IUPAC name is [(3S,8S,10S)-6,6-dimethyl-9,11-dioxa-6-azoniatetracyclo[5.4.0.01,5.08,10]undecan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3S,8S,10S)-6,6-dimethyl-9,11-dioxa-6-azoniatetracyclo[5.4.0.01,5.08,10]undecan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 163575035 |
| Molecular Formula | C20H22NO5S2+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | [(3S,8S,10S)-6,6-dimethyl-9,11-dioxa-6-azoniatetracyclo[5.4.0.01,5.08,10]undecan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | C[N+]1(C)C2C[C@H](OC(=O)C(O)(c3cccs3)c3cccs3)CC23O[C@@H]2O[C@H]2C31 |
| InChI | InChI=1S/C20H22NO5S2/c1-21(2)12-9-11(10-19(12)16(21)15-17(25-15)26-19)24-18(22)20(23,13-5-3-7-27-13)14-6-4-8-28-14/h3-8,11-12,15-17,23H,9-10H2,1-2H3/q+1/t11-,12?,15-,16?,17-,19?/m0/s1 |
| InChIKey | SEPAGPQYABSMKN-HLSXEIATSA-N |
| XLogP | 2.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|