C30H40N4O4S2 — CID 145233945
[7-[3-(N,2-diamino-4-formylanilino)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;ethane (PubChem CID 145233945) has the molecular formula C30H40N4O4S2 and a molecular weight of 584.81 g/mol. Its IUPAC name is [7-[3-(N,2-diamino-4-formylanilino)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;ethane.
| Compound Name | [7-[3-(N,2-diamino-4-formylanilino)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;ethane |
|---|---|
| PubChem CID | 145233945 |
| Molecular Formula | C30H40N4O4S2 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [7-[3-(N,2-diamino-4-formylanilino)propyl]-7-azaspiro[3.5]nonan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate;ethane |
| SMILES | CC.Nc1cc(C=O)ccc1N(N)CCCN1CCC2(CC1)CC(OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C28H34N4O4S2.C2H6/c29-22-16-20(19-33)6-7-23(22)32(30)11-3-10-31-12-8-27(9-13-31)17-21(18-27)36-26(34)28(35,24-4-1-14-37-24)25-5-2-15-38-25;1-2/h1-2,4-7,14-16,19,21,35H,3,8-13,17-18,29-30H2;1-2H3 |
| InChIKey | IHPZDSNQSZZTNA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|