C18H28NO3S+ — CID 70004011
[(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 70004011) has the molecular formula C18H28NO3S+ and a molecular weight of 338.49 g/mol. Its IUPAC name is [(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | [(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 70004011 |
| Molecular Formula | C18H28NO3S+ |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [(3R)-1,1-dimethylpiperidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | C[N+]1(C)CCC[C@@H](OC(=O)[C@](O)(c2cccs2)C2CCCC2)C1 |
| InChI | InChI=1S/C18H28NO3S/c1-19(2)11-5-9-15(13-19)22-17(20)18(21,14-7-3-4-8-14)16-10-6-12-23-16/h6,10,12,14-15,21H,3-5,7-9,11,13H2,1-2H3/q+1/t15-,18-/m1/s1 |
| InChIKey | SQWDPVFPJMBJHH-CRAIPNDOSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|