C19H30NO2S+ — CID 91137322
(1,1-dimethylpiperidin-1-ium-4-yl) (2S)-2-cyclopentyl-2-thiophen-2-ylpropanoate (PubChem CID 91137322) has the molecular formula C19H30NO2S+ and a molecular weight of 336.52 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) (2S)-2-cyclopentyl-2-thiophen-2-ylpropanoate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) (2S)-2-cyclopentyl-2-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 91137322 |
| Molecular Formula | C19H30NO2S+ |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) (2S)-2-cyclopentyl-2-thiophen-2-ylpropanoate |
| SMILES | C[C@](C(=O)OC1CC[N+](C)(C)CC1)(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C19H30NO2S/c1-19(15-7-4-5-8-15,17-9-6-14-23-17)18(21)22-16-10-12-20(2,3)13-11-16/h6,9,14-16H,4-5,7-8,10-13H2,1-3H3/q+1/t19-/m1/s1 |
| InChIKey | BAARGXWBKOQXOK-LJQANCHMSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|