C21H31BrNO2+ — CID 24759393
(1,1-dimethylpiperidin-1-ium-4-yl) 2-(3-bromophenyl)-2-cyclopentylpropanoate (PubChem CID 24759393) has the molecular formula C21H31BrNO2+ and a molecular weight of 409.39 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2-(3-bromophenyl)-2-cyclopentylpropanoate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-(3-bromophenyl)-2-cyclopentylpropanoate |
|---|---|
| PubChem CID | 24759393 |
| Molecular Formula | C21H31BrNO2+ |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-(3-bromophenyl)-2-cyclopentylpropanoate |
| SMILES | CC(C(=O)OC1CC[N+](C)(C)CC1)(c1cccc(Br)c1)C1CCCC1 |
| InChI | InChI=1S/C21H31BrNO2/c1-21(16-7-4-5-8-16,17-9-6-10-18(22)15-17)20(24)25-19-11-13-23(2,3)14-12-19/h6,9-10,15-16,19H,4-5,7-8,11-14H2,1-3H3/q+1 |
| InChIKey | DJNOSEGYSNBVCJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|