C20H32BrNO2S — CID 24759610
(1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(5-methylthiophen-2-yl)propanoate bromide (PubChem CID 24759610) has the molecular formula C20H32BrNO2S and a molecular weight of 430.45 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(5-methylthiophen-2-yl)propanoate bromide.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(5-methylthiophen-2-yl)propanoate bromide |
|---|---|
| PubChem CID | 24759610 |
| Molecular Formula | C20H32BrNO2S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(5-methylthiophen-2-yl)propanoate bromide |
| SMILES | Cc1ccc(C(C)(C(=O)OC2CC[N+](C)(C)CC2)C2CCCC2)s1.[Br-] |
| InChI | InChI=1S/C20H32NO2S.BrH/c1-15-9-10-18(24-15)20(2,16-7-5-6-8-16)19(22)23-17-11-13-21(3,4)14-12-17;/h9-10,16-17H,5-8,11-14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QKXDFRJRIZGBSY-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|