C18H22NO2S2+ — CID 118340186
1-azoniabicyclo[2.2.2]octan-1-yl 2,2-dithiophen-2-ylpropanoate (PubChem CID 118340186) has the molecular formula C18H22NO2S2+ and a molecular weight of 348.51 g/mol. Its IUPAC name is 1-azoniabicyclo[2.2.2]octan-1-yl 2,2-dithiophen-2-ylpropanoate.
| Compound Name | 1-azoniabicyclo[2.2.2]octan-1-yl 2,2-dithiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 118340186 |
| Molecular Formula | C18H22NO2S2+ |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-azoniabicyclo[2.2.2]octan-1-yl 2,2-dithiophen-2-ylpropanoate |
| SMILES | CC(C(=O)O[N+]12CCC(CC1)CC2)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C18H22NO2S2/c1-18(15-4-2-12-22-15,16-5-3-13-23-16)17(20)21-19-9-6-14(7-10-19)8-11-19/h2-5,12-14H,6-11H2,1H3/q+1 |
| InChIKey | ZXIMVYAXAOWKQV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|