C11H10BrO3S2- — CID 19968462
bromomethane;2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 19968462) has the molecular formula C11H10BrO3S2- and a molecular weight of 334.24 g/mol. Its IUPAC name is bromomethane;2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | bromomethane;2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 19968462 |
| Molecular Formula | C11H10BrO3S2- |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | bromomethane;2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CBr.O=C([O-])C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C10H8O3S2.CH3Br/c11-9(12)10(13,7-3-1-5-14-7)8-4-2-6-15-8;1-2/h1-6,13H,(H,11,12);1H3/p-1 |
| InChIKey | VPLYEVNQBYBSQO-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|