C8H7F3O2S — CID 71067149
4,4,4-trifluoro-3-hydroxy-3-thiophen-2-ylbutan-2-one (PubChem CID 71067149) has the molecular formula C8H7F3O2S and a molecular weight of 224.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-ylbutan-2-one.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 71067149 |
| Molecular Formula | C8H7F3O2S |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-ylbutan-2-one |
| SMILES | CC(=O)C(O)(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H7F3O2S/c1-5(12)7(13,8(9,10)11)6-3-2-4-14-6/h2-4,13H,1H3 |
| InChIKey | CBHDRBVAFLBYKC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |