C7H8F3NOS — CID 95011095
(2S)-3-amino-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol (PubChem CID 95011095) has the molecular formula C7H8F3NOS and a molecular weight of 211.21 g/mol. Its IUPAC name is (2S)-3-amino-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol.
| Compound Name | (2S)-3-amino-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 95011095 |
| Molecular Formula | C7H8F3NOS |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | (2S)-3-amino-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol |
| SMILES | NC[C@@](O)(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NOS/c8-7(9,10)6(12,4-11)5-2-1-3-13-5/h1-3,12H,4,11H2/t6-/m1/s1 |
| InChIKey | WOCYIZDOSCEUGS-ZCFIWIBFSA-N |
| XLogP | 1.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |