C8H6F6O2S — CID 10779091
1,1,1,4,4,4-hexafluoro-2-thiophen-2-ylbutane-2,3-diol (PubChem CID 10779091) has the molecular formula C8H6F6O2S and a molecular weight of 280.19 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-thiophen-2-ylbutane-2,3-diol.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-thiophen-2-ylbutane-2,3-diol |
|---|---|
| PubChem CID | 10779091 |
| Molecular Formula | C8H6F6O2S |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-thiophen-2-ylbutane-2,3-diol |
| SMILES | OC(C(F)(F)F)C(O)(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H6F6O2S/c9-7(10,11)5(15)6(16,8(12,13)14)4-2-1-3-17-4/h1-3,5,15-16H |
| InChIKey | GYDITZIJARFSHU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |