C11H11F3OS — CID 163132831
(2S)-3-cyclobutylidene-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol (PubChem CID 163132831) has the molecular formula C11H11F3OS and a molecular weight of 248.27 g/mol. Its IUPAC name is (2S)-3-cyclobutylidene-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol.
| Compound Name | (2S)-3-cyclobutylidene-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 163132831 |
| Molecular Formula | C11H11F3OS |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (2S)-3-cyclobutylidene-1,1,1-trifluoro-2-thiophen-2-ylpropan-2-ol |
| SMILES | O[C@](C=C1CCC1)(c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3OS/c12-11(13,14)10(15,7-8-3-1-4-8)9-5-2-6-16-9/h2,5-7,15H,1,3-4H2/t10-/m1/s1 |
| InChIKey | GUWYDURDCKIMOC-SNVBAGLBSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|