C11H10O2S2 — CID 23553455
1-hydroxy-1,1-dithiophen-2-ylpropan-2-one (PubChem CID 23553455) has the molecular formula C11H10O2S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-hydroxy-1,1-dithiophen-2-ylpropan-2-one.
| Compound Name | 1-hydroxy-1,1-dithiophen-2-ylpropan-2-one |
|---|---|
| PubChem CID | 23553455 |
| Molecular Formula | C11H10O2S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 1-hydroxy-1,1-dithiophen-2-ylpropan-2-one |
| SMILES | CC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C11H10O2S2/c1-8(12)11(13,9-4-2-6-14-9)10-5-3-7-15-10/h2-7,13H,1H3 |
| InChIKey | LXKBCMVVFLCGSC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |