C12H20N2OS — CID 110870552
1,1-diethyl-3-(2-thiophen-2-ylpropan-2-yl)urea (PubChem CID 110870552) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-thiophen-2-ylpropan-2-yl)urea.
| Compound Name | 1,1-diethyl-3-(2-thiophen-2-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 110870552 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1,1-diethyl-3-(2-thiophen-2-ylpropan-2-yl)urea |
| SMILES | CCN(CC)C(=O)NC(C)(C)c1cccs1 |
| InChI | InChI=1S/C12H20N2OS/c1-5-14(6-2)11(15)13-12(3,4)10-8-7-9-16-10/h7-9H,5-6H2,1-4H3,(H,13,15) |
| InChIKey | PDILTLHYIKYLAS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |