C17H24N2O2S2 — CID 118627890
3-[(2S)-2-hydroxyhexan-2-yl]-1,1-bis(thiophen-2-ylmethyl)urea (PubChem CID 118627890) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxyhexan-2-yl]-1,1-bis(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[(2S)-2-hydroxyhexan-2-yl]-1,1-bis(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 118627890 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-[(2S)-2-hydroxyhexan-2-yl]-1,1-bis(thiophen-2-ylmethyl)urea |
| SMILES | CCCC[C@](C)(O)NC(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H24N2O2S2/c1-3-4-9-17(2,21)18-16(20)19(12-14-7-5-10-22-14)13-15-8-6-11-23-15/h5-8,10-11,21H,3-4,9,12-13H2,1-2H3,(H,18,20)/t17-/m0/s1 |
| InChIKey | HAMZDVQIZORTFU-KRWDZBQOSA-N |
| XLogP | 4.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|