C17H22N2O3S2 — CID 87945006
[(2S)-2-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamic acid (PubChem CID 87945006) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is [(2S)-2-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S)-2-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87945006 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [(2S)-2-[bis(thiophen-2-ylmethyl)amino]-1-oxohexan-2-yl]carbamic acid |
| SMILES | CCCC[C@](C=O)(NC(=O)O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-2-3-8-17(13-20,18-16(21)22)19(11-14-6-4-9-23-14)12-15-7-5-10-24-15/h4-7,9-10,13,18H,2-3,8,11-12H2,1H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | URRAAHXEFQYBGO-KRWDZBQOSA-N |
| XLogP | 4.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|