C14H23NO2S — CID 65254843
5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid (PubChem CID 65254843) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 65254843 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid |
| SMILES | CCN(CCCC(C)(C)C(=O)O)Cc1cccs1 |
| InChI | InChI=1S/C14H23NO2S/c1-4-15(11-12-7-5-10-18-12)9-6-8-14(2,3)13(16)17/h5,7,10H,4,6,8-9,11H2,1-3H3,(H,16,17) |
| InChIKey | BRMNFWKJBNUDPN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |