5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid

C14H23NO2S — CID 65254843

IUPAC5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid
SMILESCCN(CCCC(C)(C)C(=O)O)Cc1cccs1
InChIInChI=1S/C14H23NO2S/c1-4-15(11-12-7-5-10-18-12)9-6-8-14(2,3)13(16)17/h5,7,10H,4,6,8-9,11H2,1-3H3,(H,16,17)
InChIKeyBRMNFWKJBNUDPN-UHFFFAOYSA-N
MW269.41 g/mol
LogP3.46
Rot. Bonds8

About 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid

5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid (PubChem CID 65254843) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid.

Molecular Properties

Compound Name5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid
PubChem CID65254843
Molecular FormulaC14H23NO2S
Molecular Weight269.41 g/mol
Exact Mass269.14
IUPAC Name5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid
SMILESCCN(CCCC(C)(C)C(=O)O)Cc1cccs1
InChIInChI=1S/C14H23NO2S/c1-4-15(11-12-7-5-10-18-12)9-6-8-14(2,3)13(16)17/h5,7,10H,4,6,8-9,11H2,1-3H3,(H,16,17)
InChIKeyBRMNFWKJBNUDPN-UHFFFAOYSA-N
XLogP3.46
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.41
LogP ≤ 53.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid?
The IUPAC name of 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid (CID 65254843) is 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid.
What is the SMILES notation for 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid?
The canonical SMILES for 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid is CCN(CCCC(C)(C)C(=O)O)Cc1cccs1.
What is the InChIKey of 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid?
The InChIKey is BRMNFWKJBNUDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2S/c1-4-15(11-12-7-5-10-18-12)9-6-8-14(2,3)13(16)17/h5,7,10H,4,6,8-9,11H2,1-3H3,(H,16,17).
What are the key properties of 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid?
5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid has a molecular weight of 269.41 g/mol, XLogP of 3.46, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl(thiophen-2-ylmethyl)amino]-2,2-dimethylpentanoic acid is sourced from PubChem (CID 65254843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).