C13H23N3S — CID 65259252
2,2-dimethyl-5-[methyl(thiophen-2-ylmethyl)amino]pentanimidamide (PubChem CID 65259252) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 2,2-dimethyl-5-[methyl(thiophen-2-ylmethyl)amino]pentanimidamide.
| Compound Name | 2,2-dimethyl-5-[methyl(thiophen-2-ylmethyl)amino]pentanimidamide |
|---|---|
| PubChem CID | 65259252 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2,2-dimethyl-5-[methyl(thiophen-2-ylmethyl)amino]pentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(C)Cc1cccs1 |
| InChI | InChI=1S/C13H23N3S/c1-13(2,12(14)15)7-5-8-16(3)10-11-6-4-9-17-11/h4,6,9H,5,7-8,10H2,1-3H3,(H3,14,15) |
| InChIKey | GBDPKPAHADFZJP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|