C14H24N2S — CID 62210978
N-methyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 62210978) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N-methyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | N-methyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 62210978 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-methyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | CN(CCCC1CCNCC1)Cc1cccs1 |
| InChI | InChI=1S/C14H24N2S/c1-16(12-14-5-3-11-17-14)10-2-4-13-6-8-15-9-7-13/h3,5,11,13,15H,2,4,6-10,12H2,1H3 |
| InChIKey | BZIDYDDWHMKSSO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |