C13H21BrN2S — CID 115211660
N-[(5-bromothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-ylethanamine (PubChem CID 115211660) has the molecular formula C13H21BrN2S and a molecular weight of 317.30 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-ylethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-ylethanamine |
|---|---|
| PubChem CID | 115211660 |
| Molecular Formula | C13H21BrN2S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-ylethanamine |
| SMILES | CN(CCC1CCNCC1)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C13H21BrN2S/c1-16(10-12-2-3-13(14)17-12)9-6-11-4-7-15-8-5-11/h2-3,11,15H,4-10H2,1H3 |
| InChIKey | DRPCCGNEKZNNTL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |