C10H16BrClN2S — CID 119923094
N-[(5-bromothiophen-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 119923094) has the molecular formula C10H16BrClN2S and a molecular weight of 311.68 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119923094 |
| Molecular Formula | C10H16BrClN2S |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CN(Cc1ccc(Br)s1)C1CCNC1.Cl |
| InChI | InChI=1S/C10H15BrN2S.ClH/c1-13(8-4-5-12-6-8)7-9-2-3-10(11)14-9;/h2-3,8,12H,4-7H2,1H3;1H |
| InChIKey | LHNYKDHJIFBPLY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |