C12H20BrClN2S — CID 119929706
N-[(5-bromothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 119929706) has the molecular formula C12H20BrClN2S and a molecular weight of 339.73 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119929706 |
| Molecular Formula | C12H20BrClN2S |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | CN(Cc1ccc(Br)s1)CC1CCNCC1.Cl |
| InChI | InChI=1S/C12H19BrN2S.ClH/c1-15(8-10-4-6-14-7-5-10)9-11-2-3-12(13)16-11;/h2-3,10,14H,4-9H2,1H3;1H |
| InChIKey | LGELYPYLIYQQNC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |