C14H22BrClN2 — CID 119929518
N-[(4-bromophenyl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 119929518) has the molecular formula C14H22BrClN2 and a molecular weight of 333.70 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | N-[(4-bromophenyl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119929518 |
| Molecular Formula | C14H22BrClN2 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-methyl-1-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | CN(Cc1ccc(Br)cc1)CC1CCNCC1.Cl |
| InChI | InChI=1S/C14H21BrN2.ClH/c1-17(11-13-6-8-16-9-7-13)10-12-2-4-14(15)5-3-12;/h2-5,13,16H,6-11H2,1H3;1H |
| InChIKey | ZGDOSPWCNWISFM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |