C12H22Cl2N2S — CID 69497458
N-ethyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride (PubChem CID 69497458) has the molecular formula C12H22Cl2N2S and a molecular weight of 297.29 g/mol. Its IUPAC name is N-ethyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride.
| Compound Name | N-ethyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 69497458 |
| Molecular Formula | C12H22Cl2N2S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-ethyl-N-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride |
| SMILES | CCN(Cc1cccs1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C12H20N2S.2ClH/c1-2-14(10-12-4-3-9-15-12)11-5-7-13-8-6-11;;/h3-4,9,11,13H,2,5-8,10H2,1H3;2*1H |
| InChIKey | GTRMLFKJKCUOIW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |