C15H26ClN3OS — CID 119933163
2-[piperidin-4-yl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide;hydrochloride (PubChem CID 119933163) has the molecular formula C15H26ClN3OS and a molecular weight of 331.91 g/mol. Its IUPAC name is 2-[piperidin-4-yl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-[piperidin-4-yl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119933163 |
| Molecular Formula | C15H26ClN3OS |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[piperidin-4-yl(propyl)amino]-N-(thiophen-2-ylmethyl)acetamide;hydrochloride |
| SMILES | CCCN(CC(=O)NCc1cccs1)C1CCNCC1.Cl |
| InChI | InChI=1S/C15H25N3OS.ClH/c1-2-9-18(13-5-7-16-8-6-13)12-15(19)17-11-14-4-3-10-20-14;/h3-4,10,13,16H,2,5-9,11-12H2,1H3,(H,17,19);1H |
| InChIKey | DQHJMTLIXIQIOJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |