C16H27N3S — CID 80551288
N-(2-methyl-2-piperazin-1-ylpropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine (PubChem CID 80551288) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is N-(2-methyl-2-piperazin-1-ylpropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine.
| Compound Name | N-(2-methyl-2-piperazin-1-ylpropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 80551288 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-(2-methyl-2-piperazin-1-ylpropyl)-N-(thiophen-2-ylmethyl)cyclopropanamine |
| SMILES | CC(C)(CN(Cc1cccs1)C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C16H27N3S/c1-16(2,19-9-7-17-8-10-19)13-18(14-5-6-14)12-15-4-3-11-20-15/h3-4,11,14,17H,5-10,12-13H2,1-2H3 |
| InChIKey | YRZVHIDCLWMRJA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |