C16H21ClN2OS2 — CID 119271762
N,N-bis(thiophen-2-ylmethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119271762) has the molecular formula C16H21ClN2OS2 and a molecular weight of 356.94 g/mol. Its IUPAC name is N,N-bis(thiophen-2-ylmethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N,N-bis(thiophen-2-ylmethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119271762 |
| Molecular Formula | C16H21ClN2OS2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N,N-bis(thiophen-2-ylmethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(C1CCNCC1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C16H20N2OS2.ClH/c19-16(13-5-7-17-8-6-13)18(11-14-3-1-9-20-14)12-15-4-2-10-21-15;/h1-4,9-10,13,17H,5-8,11-12H2;1H |
| InChIKey | RUPVNXKOBDTBGZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |