C16H20N2OS2 — CID 60936813
N,N-bis(thiophen-2-ylmethyl)piperidine-2-carboxamide (PubChem CID 60936813) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N,N-bis(thiophen-2-ylmethyl)piperidine-2-carboxamide.
| Compound Name | N,N-bis(thiophen-2-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 60936813 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N,N-bis(thiophen-2-ylmethyl)piperidine-2-carboxamide |
| SMILES | O=C(C1CCCCN1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C16H20N2OS2/c19-16(15-7-1-2-8-17-15)18(11-13-5-3-9-20-13)12-14-6-4-10-21-14/h3-6,9-10,15,17H,1-2,7-8,11-12H2 |
| InChIKey | QMMRZLZHFVSIEO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |