C11H17ClN2OS — CID 119267121
N-methyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119267121) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is N-methyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-methyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119267121 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-methyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CN(Cc1cccs1)C(=O)C1CCCN1.Cl |
| InChI | InChI=1S/C11H16N2OS.ClH/c1-13(8-9-4-3-7-15-9)11(14)10-5-2-6-12-10;/h3-4,7,10,12H,2,5-6,8H2,1H3;1H |
| InChIKey | XOUHAYADOCQHJT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |