C13H18N2OS — CID 54870571
N-cyclopropyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 54870571) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is N-cyclopropyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54870571 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(C1CCCN1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C13H18N2OS/c16-13(12-4-1-7-14-12)15(10-5-6-10)9-11-3-2-8-17-11/h2-3,8,10,12,14H,1,4-7,9H2 |
| InChIKey | SNLGCJFPKJHPHI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |