C16H27ClN2OS — CID 119690004
N-ethyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)butanamide;hydrochloride (PubChem CID 119690004) has the molecular formula C16H27ClN2OS and a molecular weight of 330.93 g/mol. Its IUPAC name is N-ethyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)butanamide;hydrochloride.
| Compound Name | N-ethyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119690004 |
| Molecular Formula | C16H27ClN2OS |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-ethyl-3-piperidin-4-yl-N-(thiophen-2-ylmethyl)butanamide;hydrochloride |
| SMILES | CCN(Cc1cccs1)C(=O)CC(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C16H26N2OS.ClH/c1-3-18(12-15-5-4-10-20-15)16(19)11-13(2)14-6-8-17-9-7-14;/h4-5,10,13-14,17H,3,6-9,11-12H2,1-2H3;1H |
| InChIKey | INOPXRJOLUCSKL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |