C15H27N3OS — CID 79493840
N'-hydroxy-2,2-dimethyl-5-[methyl(1-thiophen-2-ylpropan-2-yl)amino]pentanimidamide (PubChem CID 79493840) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-5-[methyl(1-thiophen-2-ylpropan-2-yl)amino]pentanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-5-[methyl(1-thiophen-2-ylpropan-2-yl)amino]pentanimidamide |
|---|---|
| PubChem CID | 79493840 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-5-[methyl(1-thiophen-2-ylpropan-2-yl)amino]pentanimidamide |
| SMILES | CC(Cc1cccs1)N(C)CCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C15H27N3OS/c1-12(11-13-7-5-10-20-13)18(4)9-6-8-15(2,3)14(16)17-19/h5,7,10,12,19H,6,8-9,11H2,1-4H3,(H2,16,17) |
| InChIKey | HTYCCHMUTOQABY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|