C14H25N3OS — CID 106711482
N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-thiophen-2-ylethyl]amino]hexanimidamide (PubChem CID 106711482) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-thiophen-2-ylethyl]amino]hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-thiophen-2-ylethyl]amino]hexanimidamide |
|---|---|
| PubChem CID | 106711482 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-thiophen-2-ylethyl]amino]hexanimidamide |
| SMILES | C[C@H](NCCCCC(C)(C)/C(N)=N/O)c1cccs1 |
| InChI | InChI=1S/C14H25N3OS/c1-11(12-7-6-10-19-12)16-9-5-4-8-14(2,3)13(15)17-18/h6-7,10-11,16,18H,4-5,8-9H2,1-3H3,(H2,15,17)/t11-/m0/s1 |
| InChIKey | OAMLDCMTFDBZPL-NSHDSACASA-N |
| XLogP | 3.34 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|