C16H27N3O — CID 81360398
N'-hydroxy-2,2-dimethyl-5-[[(1R)-1-(3-methylphenyl)ethyl]amino]pentanimidamide (PubChem CID 81360398) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-5-[[(1R)-1-(3-methylphenyl)ethyl]amino]pentanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-5-[[(1R)-1-(3-methylphenyl)ethyl]amino]pentanimidamide |
|---|---|
| PubChem CID | 81360398 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-5-[[(1R)-1-(3-methylphenyl)ethyl]amino]pentanimidamide |
| SMILES | Cc1cccc([C@@H](C)NCCCC(C)(C)/C(N)=N/O)c1 |
| InChI | InChI=1S/C16H27N3O/c1-12-7-5-8-14(11-12)13(2)18-10-6-9-16(3,4)15(17)19-20/h5,7-8,11,13,18,20H,6,9-10H2,1-4H3,(H2,17,19)/t13-/m1/s1 |
| InChIKey | VKDJWDPEIAQJNN-CYBMUJFWSA-N |
| XLogP | 3.20 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|