C17H29N3O — CID 106711462
N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-(3-methylphenyl)ethyl]amino]hexanimidamide (PubChem CID 106711462) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-(3-methylphenyl)ethyl]amino]hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-(3-methylphenyl)ethyl]amino]hexanimidamide |
|---|---|
| PubChem CID | 106711462 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-[[(1S)-1-(3-methylphenyl)ethyl]amino]hexanimidamide |
| SMILES | Cc1cccc([C@H](C)NCCCCC(C)(C)/C(N)=N/O)c1 |
| InChI | InChI=1S/C17H29N3O/c1-13-8-7-9-15(12-13)14(2)19-11-6-5-10-17(3,4)16(18)20-21/h7-9,12,14,19,21H,5-6,10-11H2,1-4H3,(H2,18,20)/t14-/m0/s1 |
| InChIKey | CXYZAIOVUBIZHX-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|