C30H28F3O3PS — CID 10030602
tert-butyl 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-yl-2-(triphenyl-λ5-phosphanylidene)butanoate (PubChem CID 10030602) has the molecular formula C30H28F3O3PS and a molecular weight of 556.59 g/mol. Its IUPAC name is tert-butyl 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-yl-2-(triphenyl-λ5-phosphanylidene)butanoate.
| Compound Name | tert-butyl 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-yl-2-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 10030602 |
| Molecular Formula | C30H28F3O3PS |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | tert-butyl 4,4,4-trifluoro-3-hydroxy-3-thiophen-2-yl-2-(triphenyl-λ5-phosphanylidene)butanoate |
| SMILES | CC(C)(C)OC(=O)C(C(O)(c1cccs1)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28F3O3PS/c1-28(2,3)36-27(34)26(29(35,30(31,32)33)25-20-13-21-38-25)37(22-14-7-4-8-15-22,23-16-9-5-10-17-23)24-18-11-6-12-19-24/h4-21,35H,1-3H3 |
| InChIKey | WEWFEQYFFRFOBB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|