C29H31O3P — CID 14780260
tert-butyl 3-oxo-2-(triphenyl-lambda5-phosphanylidene)hept-6-enoate (PubChem CID 14780260) has the molecular formula C29H31O3P and a molecular weight of 458.54 g/mol. Its IUPAC name is tert-butyl 3-oxo-2-(triphenyl-lambda5-phosphanylidene)hept-6-enoate.
| Compound Name | tert-butyl 3-oxo-2-(triphenyl-lambda5-phosphanylidene)hept-6-enoate |
|---|---|
| PubChem CID | 14780260 |
| Molecular Formula | C29H31O3P |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | tert-butyl 3-oxo-2-(triphenyl-lambda5-phosphanylidene)hept-6-enoate |
| SMILES | C=CCCC(=O)C(C(=O)OC(C)(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31O3P/c1-5-6-22-26(30)27(28(31)32-29(2,3)4)33(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h5,7-21H,1,6,22H2,2-4H3 |
| InChIKey | QGUFUMAIZUKFOB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|