C37H48NO5PSi — CID 11331199
tert-butyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)butanoate (PubChem CID 11331199) has the molecular formula C37H48NO5PSi and a molecular weight of 645.85 g/mol. Its IUPAC name is tert-butyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)butanoate.
| Compound Name | tert-butyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 11331199 |
| Molecular Formula | C37H48NO5PSi |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | tert-butyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxo-2-(triphenyl-λ5-phosphanylidene)butanoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1CC(=O)C(C(=O)OC(C)(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H48NO5PSi/c1-26(43-45(8,9)37(5,6)7)32-30(38-34(32)40)25-31(39)33(35(41)42-36(2,3)4)44(27-19-13-10-14-20-27,28-21-15-11-16-22-28)29-23-17-12-18-24-29/h10-24,26,30,32H,25H2,1-9H3,(H,38,40)/t26-,30-,32-/m1/s1 |
| InChIKey | HJRAKABRKPDTSZ-HUDILLDJSA-N |
| XLogP | 5.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|