C22H31NO4Si — CID 11069440
4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-2-ynyl benzoate (PubChem CID 11069440) has the molecular formula C22H31NO4Si and a molecular weight of 401.58 g/mol. Its IUPAC name is 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-2-ynyl benzoate.
| Compound Name | 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-2-ynyl benzoate |
|---|---|
| PubChem CID | 11069440 |
| Molecular Formula | C22H31NO4Si |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-2-ynyl benzoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1CC#CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H31NO4Si/c1-16(27-28(5,6)22(2,3)4)19-18(23-20(19)24)14-10-11-15-26-21(25)17-12-8-7-9-13-17/h7-9,12-13,16,18-19H,14-15H2,1-6H3,(H,23,24)/t16-,18-,19-/m1/s1 |
| InChIKey | FNNWYBRXHWVJIC-BHIYHBOVSA-N |
| XLogP | 3.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|