C21H32INO4Si — CID 70457954
[iodo(phenyl)methyl] (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate (PubChem CID 70457954) has the molecular formula C21H32INO4Si and a molecular weight of 517.48 g/mol. Its IUPAC name is [iodo(phenyl)methyl] (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate.
| Compound Name | [iodo(phenyl)methyl] (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate |
|---|---|
| PubChem CID | 70457954 |
| Molecular Formula | C21H32INO4Si |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | [iodo(phenyl)methyl] (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate |
| SMILES | C[C@H](C(=O)OC(I)c1ccccc1)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32INO4Si/c1-13(20(25)26-18(22)15-11-9-8-10-12-15)17-16(19(24)23-17)14(2)27-28(6,7)21(3,4)5/h8-14,16-18H,1-7H3,(H,23,24)/t13-,14+,16+,17+,18?/m0/s1 |
| InChIKey | PFOWGXINIZCQOF-BGDHGMISSA-N |
| XLogP | 4.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|