C17H29N3O3Si — CID 58434557
3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-imidazol-1-yl-1-oxopropan-2-yl]azetidin-2-one (PubChem CID 58434557) has the molecular formula C17H29N3O3Si and a molecular weight of 351.52 g/mol. Its IUPAC name is 3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-imidazol-1-yl-1-oxopropan-2-yl]azetidin-2-one.
| Compound Name | 3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-imidazol-1-yl-1-oxopropan-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 58434557 |
| Molecular Formula | C17H29N3O3Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-imidazol-1-yl-1-oxopropan-2-yl]azetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C1C(=O)NC1[C@@H](C)C(=O)n1ccnc1 |
| InChI | InChI=1S/C17H29N3O3Si/c1-11(16(22)20-9-8-18-10-20)14-13(15(21)19-14)12(2)23-24(6,7)17(3,4)5/h8-14H,1-7H3,(H,19,21)/t11-,12-,13?,14?/m1/s1 |
| InChIKey | PVRZROQJCDGVMZ-IWMBGFJWSA-N |
| XLogP | 2.68 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|