C20H31NO2S2Si — CID 57126235
phenyl (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanedithioate (PubChem CID 57126235) has the molecular formula C20H31NO2S2Si and a molecular weight of 409.69 g/mol. Its IUPAC name is phenyl (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanedithioate.
| Compound Name | phenyl (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanedithioate |
|---|---|
| PubChem CID | 57126235 |
| Molecular Formula | C20H31NO2S2Si |
| Molecular Weight | 409.69 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | phenyl (2S)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanedithioate |
| SMILES | C[C@H](C(=S)Sc1ccccc1)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31NO2S2Si/c1-13(19(24)25-15-11-9-8-10-12-15)17-16(18(22)21-17)14(2)23-26(6,7)20(3,4)5/h8-14,16-17H,1-7H3,(H,21,22)/t13-,14+,16+,17+/m0/s1 |
| InChIKey | ZMPHKRFXUHMTIM-XOSAIJSUSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|