C18H29NO2SeSi — CID 11165439
(3S,4R)-4-benzylselanyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one (PubChem CID 11165439) has the molecular formula C18H29NO2SeSi and a molecular weight of 398.48 g/mol. Its IUPAC name is (3S,4R)-4-benzylselanyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one.
| Compound Name | (3S,4R)-4-benzylselanyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 11165439 |
| Molecular Formula | C18H29NO2SeSi |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (3S,4R)-4-benzylselanyl-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1[Se]Cc1ccccc1 |
| InChI | InChI=1S/C18H29NO2SeSi/c1-13(21-23(5,6)18(2,3)4)15-16(20)19-17(15)22-12-14-10-8-7-9-11-14/h7-11,13,15,17H,12H2,1-6H3,(H,19,20)/t13-,15+,17-/m1/s1 |
| InChIKey | NUNDIXKTGVUZQF-UKPHBRMFSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|