C19H27NO2SSi — CID 54544109
(3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylsulfanylethynyl)azetidin-2-one (PubChem CID 54544109) has the molecular formula C19H27NO2SSi and a molecular weight of 361.58 g/mol. Its IUPAC name is (3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylsulfanylethynyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylsulfanylethynyl)azetidin-2-one |
|---|---|
| PubChem CID | 54544109 |
| Molecular Formula | C19H27NO2SSi |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (3R,4S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-phenylsulfanylethynyl)azetidin-2-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N[C@@H]1C#CSc1ccccc1 |
| InChI | InChI=1S/C19H27NO2SSi/c1-14(22-24(5,6)19(2,3)4)17-16(20-18(17)21)12-13-23-15-10-8-7-9-11-15/h7-11,14,16-17H,1-6H3,(H,20,21)/t14-,16+,17-/m0/s1 |
| InChIKey | ZFIJBMHZAMEIKT-UAGQMJEPSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|